About 5-(oxan-3-yl)-1H-1,2,4-triazole
5-(oxan-3-yl)-1H-1,2,4-triazole (PubChem CID 172992337) has the molecular formula C7H11N3O
and a molecular weight of 153.19 g/mol. Its IUPAC name is 5-(oxan-3-yl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-(oxan-3-yl)-1H-1,2,4-triazole |
| PubChem CID | 172992337 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-(oxan-3-yl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(C2CCCOC2)n1 |
| InChI | InChI=1S/C7H11N3O/c1-2-6(4-11-3-1)7-8-5-9-10-7/h5-6H,1-4H2,(H,8,9,10) |
| InChIKey | SEUOVUOYZCGQHV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(oxan-3-yl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-3-yl)-1H-1,2,4-triazole?
The IUPAC name of 5-(oxan-3-yl)-1H-1,2,4-triazole (CID 172992337) is 5-(oxan-3-yl)-1H-1,2,4-triazole.
What is the SMILES notation for 5-(oxan-3-yl)-1H-1,2,4-triazole?
The canonical SMILES for 5-(oxan-3-yl)-1H-1,2,4-triazole is c1n[nH]c(C2CCCOC2)n1.
What is the InChIKey of 5-(oxan-3-yl)-1H-1,2,4-triazole?
The InChIKey is SEUOVUOYZCGQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-2-6(4-11-3-1)7-8-5-9-10-7/h5-6H,1-4H2,(H,8,9,10).
What are the key properties of 5-(oxan-3-yl)-1H-1,2,4-triazole?
5-(oxan-3-yl)-1H-1,2,4-triazole has a molecular weight of 153.19 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-3-yl)-1H-1,2,4-triazole is sourced from PubChem (CID 172992337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).