C7H11N3O — CID 172992337
5-(oxan-3-yl)-1H-1,2,4-triazole (PubChem CID 172992337) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 5-(oxan-3-yl)-1H-1,2,4-triazole.
| Compound Name | 5-(oxan-3-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 172992337 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-(oxan-3-yl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(C2CCCOC2)n1 |
| InChI | InChI=1S/C7H11N3O/c1-2-6(4-11-3-1)7-8-5-9-10-7/h5-6H,1-4H2,(H,8,9,10) |
| InChIKey | SEUOVUOYZCGQHV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |