C15H27N3 — CID 114282263
5-cyclohexyl-3-(2,4-dimethylpentan-3-yl)-1H-1,2,4-triazole (PubChem CID 114282263) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-cyclohexyl-3-(2,4-dimethylpentan-3-yl)-1H-1,2,4-triazole.
| Compound Name | 5-cyclohexyl-3-(2,4-dimethylpentan-3-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 114282263 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 5-cyclohexyl-3-(2,4-dimethylpentan-3-yl)-1H-1,2,4-triazole |
| SMILES | CC(C)C(c1n[nH]c(C2CCCCC2)n1)C(C)C |
| InChI | InChI=1S/C15H27N3/c1-10(2)13(11(3)4)15-16-14(17-18-15)12-8-6-5-7-9-12/h10-13H,5-9H2,1-4H3,(H,16,17,18) |
| InChIKey | IVTBWUOUOYDWML-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |