C9H15N3O — CID 66263854
(1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)ethanol (PubChem CID 66263854) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)ethanol.
| Compound Name | (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)ethanol |
|---|---|
| PubChem CID | 66263854 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)ethanol |
| SMILES | C[C@H](O)c1n[nH]c(C2CCCC2)n1 |
| InChI | InChI=1S/C9H15N3O/c1-6(13)8-10-9(12-11-8)7-4-2-3-5-7/h6-7,13H,2-5H2,1H3,(H,10,11,12)/t6-/m0/s1 |
| InChIKey | ATECLOLOGXQKLT-LURJTMIESA-N |
| XLogP | 1.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |