C8H14N4 — CID 163409809
(1S)-1-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)ethanamine (PubChem CID 163409809) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is (1S)-1-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | (1S)-1-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 163409809 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (1S)-1-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)ethanamine |
| SMILES | C[C@H](N)c1n[nH]c(C2CCC2)n1 |
| InChI | InChI=1S/C8H14N4/c1-5(9)7-10-8(12-11-7)6-3-2-4-6/h5-6H,2-4,9H2,1H3,(H,10,11,12)/t5-/m0/s1 |
| InChIKey | ANDVDDLRTOFCQB-YFKPBYRVSA-N |
| XLogP | 1.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |