C12H22N4 — CID 107146724
(1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pentan-1-amine (PubChem CID 107146724) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pentan-1-amine.
| Compound Name | (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 107146724 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (1S)-1-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pentan-1-amine |
| SMILES | CCCC[C@H](N)c1n[nH]c(C2CCCC2)n1 |
| InChI | InChI=1S/C12H22N4/c1-2-3-8-10(13)12-14-11(15-16-12)9-6-4-5-7-9/h9-10H,2-8,13H2,1H3,(H,14,15,16)/t10-/m0/s1 |
| InChIKey | FWUOOJPOUAGMOK-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |