C11H13BrCl2N2 — CID 66314551
5-bromo-4,6-dichloro-2-(3-ethylcyclopentyl)pyrimidine (PubChem CID 66314551) has the molecular formula C11H13BrCl2N2 and a molecular weight of 324.05 g/mol. Its IUPAC name is 5-bromo-4,6-dichloro-2-(3-ethylcyclopentyl)pyrimidine.
| Compound Name | 5-bromo-4,6-dichloro-2-(3-ethylcyclopentyl)pyrimidine |
|---|---|
| PubChem CID | 66314551 |
| Molecular Formula | C11H13BrCl2N2 |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-bromo-4,6-dichloro-2-(3-ethylcyclopentyl)pyrimidine |
| SMILES | CCC1CCC(c2nc(Cl)c(Br)c(Cl)n2)C1 |
| InChI | InChI=1S/C11H13BrCl2N2/c1-2-6-3-4-7(5-6)11-15-9(13)8(12)10(14)16-11/h6-7H,2-5H2,1H3 |
| InChIKey | FEZSRLYRFBTISH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |