C11H16N2O — CID 65413474
5-ethenyl-3-(3-ethylcyclopentyl)-1,2,4-oxadiazole (PubChem CID 65413474) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-ethenyl-3-(3-ethylcyclopentyl)-1,2,4-oxadiazole.
| Compound Name | 5-ethenyl-3-(3-ethylcyclopentyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65413474 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-ethenyl-3-(3-ethylcyclopentyl)-1,2,4-oxadiazole |
| SMILES | C=Cc1nc(C2CCC(CC)C2)no1 |
| InChI | InChI=1S/C11H16N2O/c1-3-8-5-6-9(7-8)11-12-10(4-2)14-13-11/h4,8-9H,2-3,5-7H2,1H3 |
| InChIKey | CHYZGHKEPAIXHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |