C12H18N2O — CID 65389570
3-(4,4-dimethylcyclohexyl)-5-ethenyl-1,2,4-oxadiazole (PubChem CID 65389570) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(4,4-dimethylcyclohexyl)-5-ethenyl-1,2,4-oxadiazole.
| Compound Name | 3-(4,4-dimethylcyclohexyl)-5-ethenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65389570 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(4,4-dimethylcyclohexyl)-5-ethenyl-1,2,4-oxadiazole |
| SMILES | C=Cc1nc(C2CCC(C)(C)CC2)no1 |
| InChI | InChI=1S/C12H18N2O/c1-4-10-13-11(14-15-10)9-5-7-12(2,3)8-6-9/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | LIBFTOUNFRRPQY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |