C16H22N4O — CID 107811681
5-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine (PubChem CID 107811681) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine.
| Compound Name | 5-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811681 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
| SMILES | CC1(C)CCC(c2noc(-c3cc(N)cc(N)c3)n2)CC1 |
| InChI | InChI=1S/C16H22N4O/c1-16(2)5-3-10(4-6-16)14-19-15(21-20-14)11-7-12(17)9-13(18)8-11/h7-10H,3-6,17-18H2,1-2H3 |
| InChIKey | MNIITBTUDGMKFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|