C14H17N3O — CID 64982375
3-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline (PubChem CID 64982375) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline.
| Compound Name | 3-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline |
|---|---|
| PubChem CID | 64982375 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(-c2nc(C3CCC3)no2)c1C |
| InChI | InChI=1S/C14H17N3O/c1-8-6-11(15)7-12(9(8)2)14-16-13(17-18-14)10-4-3-5-10/h6-7,10H,3-5,15H2,1-2H3 |
| InChIKey | IDELRSUBWATQRU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|