C11H13N3O — CID 63021546
3,4-dimethyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 63021546) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 3,4-dimethyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 3,4-dimethyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 63021546 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3,4-dimethyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Cc1noc(-c2cc(N)cc(C)c2C)n1 |
| InChI | InChI=1S/C11H13N3O/c1-6-4-9(12)5-10(7(6)2)11-13-8(3)14-15-11/h4-5H,12H2,1-3H3 |
| InChIKey | XZWGCGHSIUKMIX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|