C14H19N3O — CID 55229788
3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline (PubChem CID 55229788) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline.
| Compound Name | 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline |
|---|---|
| PubChem CID | 55229788 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-4,5-dimethylaniline |
| SMILES | CCC(C)c1noc(-c2cc(N)cc(C)c2C)n1 |
| InChI | InChI=1S/C14H19N3O/c1-5-8(2)13-16-14(18-17-13)12-7-11(15)6-9(3)10(12)4/h6-8H,5,15H2,1-4H3 |
| InChIKey | VPMVMBMFNCPCTA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|