C16H20IN3O — CID 65391547
2-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline (PubChem CID 65391547) has the molecular formula C16H20IN3O and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline.
| Compound Name | 2-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline |
|---|---|
| PubChem CID | 65391547 |
| Molecular Formula | C16H20IN3O |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]-4-iodoaniline |
| SMILES | CC1(C)CCC(c2noc(-c3cc(I)ccc3N)n2)CC1 |
| InChI | InChI=1S/C16H20IN3O/c1-16(2)7-5-10(6-8-16)14-19-15(21-20-14)12-9-11(17)3-4-13(12)18/h3-4,9-10H,5-8,18H2,1-2H3 |
| InChIKey | LJFOBJXUIWJDCD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|