C16H20ClN3O — CID 65392148
3-chloro-4-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 65392148) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 3-chloro-4-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-chloro-4-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 65392148 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-chloro-4-[3-(4,4-dimethylcyclohexyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CC1(C)CCC(c2noc(-c3ccc(N)cc3Cl)n2)CC1 |
| InChI | InChI=1S/C16H20ClN3O/c1-16(2)7-5-10(6-8-16)14-19-15(21-20-14)12-4-3-11(18)9-13(12)17/h3-4,9-10H,5-8,18H2,1-2H3 |
| InChIKey | MRCMHCFVHIOQEU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|