C13H13Cl2N3O — CID 82830646
2,6-dichloro-4-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 82830646) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 2,6-dichloro-4-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 82830646 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2,6-dichloro-4-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Nc1c(Cl)cc(-c2nc(C3CCCC3)no2)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O/c14-9-5-8(6-10(15)11(9)16)13-17-12(18-19-13)7-3-1-2-4-7/h5-7H,1-4,16H2 |
| InChIKey | BFXNFUYIZNZTBK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|