C12H15N3O4S — CID 154752310
4-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)furan-2-sulfonamide (PubChem CID 154752310) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)furan-2-sulfonamide.
| Compound Name | 4-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 154752310 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-(3-cyclohexyl-1,2,4-oxadiazol-5-yl)furan-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nc(C3CCCCC3)no2)co1 |
| InChI | InChI=1S/C12H15N3O4S/c13-20(16,17)10-6-9(7-18-10)12-14-11(15-19-12)8-4-2-1-3-5-8/h6-8H,1-5H2,(H2,13,16,17) |
| InChIKey | LURXTATZLRFMOG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |