C24H28FNO2S — CID 118531213
5-[3-[2-(2-fluoro-4-hexylphenyl)pyrrol-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118531213) has the molecular formula C24H28FNO2S and a molecular weight of 413.56 g/mol. Its IUPAC name is 5-[3-[2-(2-fluoro-4-hexylphenyl)pyrrol-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[2-(2-fluoro-4-hexylphenyl)pyrrol-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118531213 |
| Molecular Formula | C24H28FNO2S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-[3-[2-(2-fluoro-4-hexylphenyl)pyrrol-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCc1ccc(-c2cccn2CCCc2ccc(C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C24H28FNO2S/c1-2-3-4-5-8-18-11-13-20(21(25)17-18)22-10-7-16-26(22)15-6-9-19-12-14-23(29-19)24(27)28/h7,10-14,16-17H,2-6,8-9,15H2,1H3,(H,27,28) |
| InChIKey | FHTXBDPYUWBMSS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|