C23H25ClN8O3 — CID 118532373
4-[(3-chloro-4-methoxyphenyl)methyldiazenyl]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-N-(pyrimidin-2-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 118532373) has the molecular formula C23H25ClN8O3 and a molecular weight of 496.96 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methyldiazenyl]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-N-(pyrimidin-2-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methyldiazenyl]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-N-(pyrimidin-2-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118532373 |
| Molecular Formula | C23H25ClN8O3 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methyldiazenyl]-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-N-(pyrimidin-2-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(C/N=N/c2nc(N3CCC[C@H]3CO)ncc2C(=O)NCc2ncccn2)cc1Cl |
| InChI | InChI=1S/C23H25ClN8O3/c1-35-19-6-5-15(10-18(19)24)11-29-31-21-17(22(34)27-13-20-25-7-3-8-26-20)12-28-23(30-21)32-9-2-4-16(32)14-33/h3,5-8,10,12,16,33H,2,4,9,11,13-14H2,1H3,(H,27,34)/b31-29+/t16-/m0/s1 |
| InChIKey | WDECTVVAIOLYIO-PLKORQQKSA-N |
| XLogP | 3.10 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|