C30H29ClN8O7 — CID 156755946
[2-[(2S)-1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-(pyrimidin-2-ylmethylcarbamoyl)pyrimidin-2-yl]pyrrolidin-2-yl]-4-nitrophenyl] methyl carbonate (PubChem CID 156755946) has the molecular formula C30H29ClN8O7 and a molecular weight of 649.06 g/mol. Its IUPAC name is [2-[(2S)-1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-(pyrimidin-2-ylmethylcarbamoyl)pyrimidin-2-yl]pyrrolidin-2-yl]-4-nitrophenyl] methyl carbonate.
| Compound Name | [2-[(2S)-1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-(pyrimidin-2-ylmethylcarbamoyl)pyrimidin-2-yl]pyrrolidin-2-yl]-4-nitrophenyl] methyl carbonate |
|---|---|
| PubChem CID | 156755946 |
| Molecular Formula | C30H29ClN8O7 |
| Molecular Weight | 649.06 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [2-[(2S)-1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-(pyrimidin-2-ylmethylcarbamoyl)pyrimidin-2-yl]pyrrolidin-2-yl]-4-nitrophenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc([N+](=O)[O-])cc1[C@@H]1CCCN1c1ncc(C(=O)NCc2ncccn2)c(NCc2ccc(OC)c(Cl)c2)n1 |
| InChI | InChI=1S/C30H29ClN8O7/c1-44-25-8-6-18(13-22(25)31)15-34-27-21(28(40)35-17-26-32-10-4-11-33-26)16-36-29(37-27)38-12-3-5-23(38)20-14-19(39(42)43)7-9-24(20)46-30(41)45-2/h4,6-11,13-14,16,23H,3,5,12,15,17H2,1-2H3,(H,35,40)(H,34,36,37)/t23-/m0/s1 |
| InChIKey | HZZZNOPWJKZIQY-QHCPKHFHSA-N |
| XLogP | 4.87 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|