C27H31ClN8O8 — CID 174232489
[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 2-(2-nitrooxyethoxy)acetate (PubChem CID 174232489) has the molecular formula C27H31ClN8O8 and a molecular weight of 631.05 g/mol. Its IUPAC name is [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 2-(2-nitrooxyethoxy)acetate.
| Compound Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 2-(2-nitrooxyethoxy)acetate |
|---|---|
| PubChem CID | 174232489 |
| Molecular Formula | C27H31ClN8O8 |
| Molecular Weight | 631.05 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 2-(2-nitrooxyethoxy)acetate |
| SMILES | COc1ccc(CNc2nc(N3CCCC3COC(=O)COCCO[N+](=O)[O-])ncc2C(=O)N(C)c2ncccn2)cc1Cl |
| InChI | InChI=1S/C27H31ClN8O8/c1-34(26-29-8-4-9-30-26)25(38)20-15-32-27(33-24(20)31-14-18-6-7-22(41-2)21(28)13-18)35-10-3-5-19(35)16-43-23(37)17-42-11-12-44-36(39)40/h4,6-9,13,15,19H,3,5,10-12,14,16-17H2,1-2H3,(H,31,32,33) |
| InChIKey | ZSZOCBQDGWYXHN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 184.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|