C30H37ClN8O8 — CID 174232493
[1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 6-nitrooxyhexyl carbonate (PubChem CID 174232493) has the molecular formula C30H37ClN8O8 and a molecular weight of 673.13 g/mol. Its IUPAC name is [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 6-nitrooxyhexyl carbonate.
| Compound Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 6-nitrooxyhexyl carbonate |
|---|---|
| PubChem CID | 174232493 |
| Molecular Formula | C30H37ClN8O8 |
| Molecular Weight | 673.13 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | [1-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5-[methyl(pyrimidin-2-yl)carbamoyl]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 6-nitrooxyhexyl carbonate |
| SMILES | COc1ccc(CNc2nc(N3CCCC3COC(=O)OCCCCCCO[N+](=O)[O-])ncc2C(=O)N(C)c2ncccn2)cc1Cl |
| InChI | InChI=1S/C30H37ClN8O8/c1-37(28-32-12-8-13-33-28)27(40)23-19-35-29(36-26(23)34-18-21-10-11-25(44-2)24(31)17-21)38-14-7-9-22(38)20-46-30(41)45-15-5-3-4-6-16-47-39(42)43/h8,10-13,17,19,22H,3-7,9,14-16,18,20H2,1-2H3,(H,34,35,36) |
| InChIKey | BFAADPSQVCIJRN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 184.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|