C24H31ClN6O8 — CID 166796530
[(2S)-1-[5-carbamoyl-4-[(3-chloro-4-methoxyphenyl)methylamino]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 3-(3-nitrooxypropoxy)propanoate (PubChem CID 166796530) has the molecular formula C24H31ClN6O8 and a molecular weight of 567.00 g/mol. Its IUPAC name is [(2S)-1-[5-carbamoyl-4-[(3-chloro-4-methoxyphenyl)methylamino]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 3-(3-nitrooxypropoxy)propanoate.
| Compound Name | [(2S)-1-[5-carbamoyl-4-[(3-chloro-4-methoxyphenyl)methylamino]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 3-(3-nitrooxypropoxy)propanoate |
|---|---|
| PubChem CID | 166796530 |
| Molecular Formula | C24H31ClN6O8 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [(2S)-1-[5-carbamoyl-4-[(3-chloro-4-methoxyphenyl)methylamino]pyrimidin-2-yl]pyrrolidin-2-yl]methyl 3-(3-nitrooxypropoxy)propanoate |
| SMILES | COc1ccc(CNc2nc(N3CCC[C@H]3COC(=O)CCOCCCO[N+](=O)[O-])ncc2C(N)=O)cc1Cl |
| InChI | InChI=1S/C24H31ClN6O8/c1-36-20-6-5-16(12-19(20)25)13-27-23-18(22(26)33)14-28-24(29-23)30-8-2-4-17(30)15-38-21(32)7-11-37-9-3-10-39-31(34)35/h5-6,12,14,17H,2-4,7-11,13,15H2,1H3,(H2,26,33)(H,27,28,29)/t17-/m0/s1 |
| InChIKey | HJHLIKOATCPDES-KRWDZBQOSA-N |
| XLogP | 2.37 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|