C17H25N5O6 — CID 169156834
[1-(5-carbamoyl-4-methylpyrimidin-2-yl)pyrrolidin-2-yl]methyl 6-nitrooxyhexanoate (PubChem CID 169156834) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is [1-(5-carbamoyl-4-methylpyrimidin-2-yl)pyrrolidin-2-yl]methyl 6-nitrooxyhexanoate.
| Compound Name | [1-(5-carbamoyl-4-methylpyrimidin-2-yl)pyrrolidin-2-yl]methyl 6-nitrooxyhexanoate |
|---|---|
| PubChem CID | 169156834 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [1-(5-carbamoyl-4-methylpyrimidin-2-yl)pyrrolidin-2-yl]methyl 6-nitrooxyhexanoate |
| SMILES | Cc1nc(N2CCCC2COC(=O)CCCCCO[N+](=O)[O-])ncc1C(N)=O |
| InChI | InChI=1S/C17H25N5O6/c1-12-14(16(18)24)10-19-17(20-12)21-8-5-6-13(21)11-27-15(23)7-3-2-4-9-28-22(25)26/h10,13H,2-9,11H2,1H3,(H2,18,24) |
| InChIKey | OPFIJBZELUCCKC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|