C29H38N2O6 — CID 118536459
tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-hydroxyamino]-3-methylbutanoate (PubChem CID 118536459) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-hydroxyamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-hydroxyamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118536459 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]-hydroxyamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(O)[C@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C29H38N2O6/c1-17(2)24(26(32)31(35)25(18(3)4)27(33)37-29(5,6)7)30-28(34)36-16-23-21-14-10-8-12-19(21)20-13-9-11-15-22(20)23/h8-15,17-18,23-25,35H,16H2,1-7H3,(H,30,34)/t24-,25-/m0/s1 |
| InChIKey | PYXMHQNLSWSPKB-DQEYMECFSA-N |
| XLogP | 5.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|