C36H35N5O4S — CID 118537364
5-[1-(benzenesulfonyl)-2-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 118537364) has the molecular formula C36H35N5O4S and a molecular weight of 633.77 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)-2-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[1-(benzenesulfonyl)-2-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 118537364 |
| Molecular Formula | C36H35N5O4S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 5-[1-(benzenesulfonyl)-2-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | CN1CCN(c2ccc(-c3cc4c(-c5ccc(OC6CCOCC6)c(C#N)c5)ccnc4n3S(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C36H35N5O4S/c1-39-17-19-40(20-18-39)29-10-7-26(8-11-29)34-24-33-32(13-16-38-36(33)41(34)46(42,43)31-5-3-2-4-6-31)27-9-12-35(28(23-27)25-37)45-30-14-21-44-22-15-30/h2-13,16,23-24,30H,14-15,17-22H2,1H3 |
| InChIKey | JFYLTYOGDKKTTB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 100.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|