C17H24N4O3 — CID 118538085
4-[3-tert-butyl-4-(hydroxyamino)-1-methyl-5-oxopyrazol-4-yl]-N,N-dimethylbenzamide (PubChem CID 118538085) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[3-tert-butyl-4-(hydroxyamino)-1-methyl-5-oxopyrazol-4-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-tert-butyl-4-(hydroxyamino)-1-methyl-5-oxopyrazol-4-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 118538085 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-[3-tert-butyl-4-(hydroxyamino)-1-methyl-5-oxopyrazol-4-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C2(NO)C(=O)N(C)N=C2C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24N4O3/c1-16(2,3)14-17(19-24,15(23)21(6)18-14)12-9-7-11(8-10-12)13(22)20(4)5/h7-10,19,24H,1-6H3 |
| InChIKey | NAJGJYFLLCTTLV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|