C15H19N3O4S — CID 118538131
2,4-dimethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1H-pyrazol-3-one (PubChem CID 118538131) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2,4-dimethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1H-pyrazol-3-one.
| Compound Name | 2,4-dimethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 118538131 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2,4-dimethyl-5-(4-morpholin-4-ylsulfonylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1c(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)[nH]n(C)c1=O |
| InChI | InChI=1S/C15H19N3O4S/c1-11-14(16-17(2)15(11)19)12-3-5-13(6-4-12)23(20,21)18-7-9-22-10-8-18/h3-6,16H,7-10H2,1-2H3 |
| InChIKey | YPGGBTPKJCVTBG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |