C16H17F2N3O4S — CID 118538383
5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]-2-methyl-3-oxo-1H-pyrazole-4-carbaldehyde (PubChem CID 118538383) has the molecular formula C16H17F2N3O4S and a molecular weight of 385.39 g/mol. Its IUPAC name is 5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]-2-methyl-3-oxo-1H-pyrazole-4-carbaldehyde.
| Compound Name | 5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]-2-methyl-3-oxo-1H-pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118538383 |
| Molecular Formula | C16H17F2N3O4S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]-2-methyl-3-oxo-1H-pyrazole-4-carbaldehyde |
| SMILES | Cn1[nH]c(-c2ccc(S(=O)(=O)N3CCC(F)(F)CC3)cc2)c(C=O)c1=O |
| InChI | InChI=1S/C16H17F2N3O4S/c1-20-15(23)13(10-22)14(19-20)11-2-4-12(5-3-11)26(24,25)21-8-6-16(17,18)7-9-21/h2-5,10,19H,6-9H2,1H3 |
| InChIKey | POOOQXJDZKXXOC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|