C15H17N3O5S — CID 118538603
2-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-3-oxo-1H-pyrazole-4-carbaldehyde (PubChem CID 118538603) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-3-oxo-1H-pyrazole-4-carbaldehyde.
| Compound Name | 2-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-3-oxo-1H-pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118538603 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-3-oxo-1H-pyrazole-4-carbaldehyde |
| SMILES | Cn1[nH]c(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)c(C=O)c1=O |
| InChI | InChI=1S/C15H17N3O5S/c1-17-15(20)13(10-19)14(16-17)11-2-4-12(5-3-11)24(21,22)18-6-8-23-9-7-18/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | OPDIYQMSRZTSGD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|