C16H21N3O5S — CID 129057116
ethyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate (PubChem CID 129057116) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is ethyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate.
| Compound Name | ethyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate |
|---|---|
| PubChem CID | 129057116 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate |
| SMILES | CCOC(=O)Cn1[nH]c(-c2ccc(S(=O)(=O)N(C)C)cc2)c(C)c1=O |
| InChI | InChI=1S/C16H21N3O5S/c1-5-24-14(20)10-19-16(21)11(2)15(17-19)12-6-8-13(9-7-12)25(22,23)18(3)4/h6-9,17H,5,10H2,1-4H3 |
| InChIKey | IRLJBDJMQPVXAA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |