C18H25N3O5S — CID 129057202
tert-butyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate (PubChem CID 129057202) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is tert-butyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate.
| Compound Name | tert-butyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate |
|---|---|
| PubChem CID | 129057202 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl 2-[5-[4-(dimethylsulfamoyl)phenyl]-4-methyl-3-oxo-1H-pyrazol-2-yl]acetate |
| SMILES | Cc1c(-c2ccc(S(=O)(=O)N(C)C)cc2)[nH]n(CC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C18H25N3O5S/c1-12-16(13-7-9-14(10-8-13)27(24,25)20(5)6)19-21(17(12)23)11-15(22)26-18(2,3)4/h7-10,19H,11H2,1-6H3 |
| InChIKey | VUTPPNKTUYCJLI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |