C11H14ClN3O — CID 118538467
N-[5-(3-chlorophenyl)-2,4-dimethyl-3H-pyrazol-4-yl]hydroxylamine (PubChem CID 118538467) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-2,4-dimethyl-3H-pyrazol-4-yl]hydroxylamine.
| Compound Name | N-[5-(3-chlorophenyl)-2,4-dimethyl-3H-pyrazol-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 118538467 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[5-(3-chlorophenyl)-2,4-dimethyl-3H-pyrazol-4-yl]hydroxylamine |
| SMILES | CN1CC(C)(NO)C(c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C11H14ClN3O/c1-11(14-16)7-15(2)13-10(11)8-4-3-5-9(12)6-8/h3-6,14,16H,7H2,1-2H3 |
| InChIKey | DRHYDPCSVOANEX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|