C32H45N3O2 — CID 118539604
N-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]piperidin-4-yl]methyl]pyridine-2-carboxamide (PubChem CID 118539604) has the molecular formula C32H45N3O2 and a molecular weight of 503.73 g/mol. Its IUPAC name is N-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]piperidin-4-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]piperidin-4-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118539604 |
| Molecular Formula | C32H45N3O2 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | N-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]piperidin-4-yl]methyl]pyridine-2-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CCC(CNC(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C32H45N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-31(36)35-26-23-29(24-27-35)28-34-32(37)30-21-19-20-25-33-30/h3-4,6-7,9-10,12-13,15-16,19-21,25,29H,2,5,8,11,14,17-18,22-24,26-28H2,1H3,(H,34,37)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | VMNFDRCGSQPKLP-JLNKQSITSA-N |
| XLogP | 6.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|