C33H48N4O3 — CID 123644831
N-[(1-icosa-5,8,11,14,17-pentaenoylpiperidin-4-yl)methyl]-N,5-dimethyl-1-oxidopyrazin-1-ium-2-carboxamide (PubChem CID 123644831) has the molecular formula C33H48N4O3 and a molecular weight of 548.77 g/mol. Its IUPAC name is N-[(1-icosa-5,8,11,14,17-pentaenoylpiperidin-4-yl)methyl]-N,5-dimethyl-1-oxidopyrazin-1-ium-2-carboxamide.
| Compound Name | N-[(1-icosa-5,8,11,14,17-pentaenoylpiperidin-4-yl)methyl]-N,5-dimethyl-1-oxidopyrazin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 123644831 |
| Molecular Formula | C33H48N4O3 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | N-[(1-icosa-5,8,11,14,17-pentaenoylpiperidin-4-yl)methyl]-N,5-dimethyl-1-oxidopyrazin-1-ium-2-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)N1CCC(CN(C)C(=O)c2cnc(C)c[n+]2[O-])CC1 |
| InChI | InChI=1S/C33H48N4O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32(38)36-24-22-30(23-25-36)28-35(3)33(39)31-26-34-29(2)27-37(31)40/h5-6,8-9,11-12,14-15,17-18,26-27,30H,4,7,10,13,16,19-25,28H2,1-3H3 |
| InChIKey | CVCITSIKDLADDM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|