C35H52N4O2 — CID 88959620
(5E,8E,11E,14E,17E)-N-[2-[methyl-[2-[[(E)-4-(6-methyl-3-pyridinyl)but-3-enoyl]amino]ethyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 88959620) has the molecular formula C35H52N4O2 and a molecular weight of 560.83 g/mol. Its IUPAC name is (5E,8E,11E,14E,17E)-N-[2-[methyl-[2-[[(E)-4-(6-methyl-3-pyridinyl)but-3-enoyl]amino]ethyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5E,8E,11E,14E,17E)-N-[2-[methyl-[2-[[(E)-4-(6-methyl-3-pyridinyl)but-3-enoyl]amino]ethyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 88959620 |
| Molecular Formula | C35H52N4O2 |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | (5E,8E,11E,14E,17E)-N-[2-[methyl-[2-[[(E)-4-(6-methyl-3-pyridinyl)but-3-enoyl]amino]ethyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NCCN(C)CCNC(=O)C/C=C/c1ccc(C)nc1 |
| InChI | InChI=1S/C35H52N4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-34(40)36-27-29-39(3)30-28-37-35(41)24-21-22-33-26-25-32(2)38-31-33/h5-6,8-9,11-12,14-15,17-18,21-22,25-26,31H,4,7,10,13,16,19-20,23-24,27-30H2,1-3H3,(H,36,40)(H,37,41)/b6-5+,9-8+,12-11+,15-14+,18-17+,22-21+ |
| InChIKey | VUYIHUOCNBZTPW-AMRSRMMXSA-N |
| XLogP | 6.88 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|