C29H50N6O2 — CID 71465585
(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]ethyl-methylamino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 71465585) has the molecular formula C29H50N6O2 and a molecular weight of 514.76 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]ethyl-methylamino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]ethyl-methylamino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 71465585 |
| Molecular Formula | C29H50N6O2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]ethyl-methylamino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | [H]/N=C(\N)N(C)CC(=O)NCCN(C)CCNC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C29H50N6O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(36)32-22-24-34(2)25-23-33-28(37)26-35(3)29(30)31/h5-6,8-9,11-12,14-15,17-18H,4,7,10,13,16,19-26H2,1-3H3,(H3,30,31)(H,32,36)(H,33,37)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | VEGHZKNFMLHMIT-AAQCHOMXSA-N |
| XLogP | 3.90 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|