C24H37N3O3 — CID 74386742
[2-[carbamimidoyl(methyl)amino]acetyl] icosa-5,8,11,14,17-pentaenoate (PubChem CID 74386742) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is [2-[carbamimidoyl(methyl)amino]acetyl] icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [2-[carbamimidoyl(methyl)amino]acetyl] icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 74386742 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | [2-[carbamimidoyl(methyl)amino]acetyl] icosa-5,8,11,14,17-pentaenoate |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C24H37N3O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(28)30-23(29)21-27(2)24(25)26/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-21H2,1-2H3,(H3,25,26) |
| InChIKey | XEJSGMSEEYIETD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|