C30H43N3O2 — CID 123971654
1-[4-(2,5-dihydropyridine-3-carbonyl)piperazin-1-yl]icosa-5,8,11,14,17-pentaen-1-one (PubChem CID 123971654) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is 1-[4-(2,5-dihydropyridine-3-carbonyl)piperazin-1-yl]icosa-5,8,11,14,17-pentaen-1-one.
| Compound Name | 1-[4-(2,5-dihydropyridine-3-carbonyl)piperazin-1-yl]icosa-5,8,11,14,17-pentaen-1-one |
|---|---|
| PubChem CID | 123971654 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | 1-[4-(2,5-dihydropyridine-3-carbonyl)piperazin-1-yl]icosa-5,8,11,14,17-pentaen-1-one |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)N1CCN(C(=O)C2=CCC=NC2)CC1 |
| InChI | InChI=1S/C30H43N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29(34)32-23-25-33(26-24-32)30(35)28-20-19-22-31-27-28/h3-4,6-7,9-10,12-13,15-16,20,22H,2,5,8,11,14,17-19,21,23-27H2,1H3 |
| InChIKey | USBOGJQMVOVALD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|