C32H29F6N3O6S2 — CID 118539897
4-[(E)-2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) (PubChem CID 118539897) has the molecular formula C32H29F6N3O6S2 and a molecular weight of 729.72 g/mol. Its IUPAC name is 4-[(E)-2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate).
| Compound Name | 4-[(E)-2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 118539897 |
| Molecular Formula | C32H29F6N3O6S2 |
| Molecular Weight | 729.72 g/mol |
| Exact Mass | 729.14 |
| IUPAC Name | 4-[(E)-2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+]3c(c2)-c2c(ccc4c2-c2cccc[n+]2CC4)CC3)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C30H29N3.2CHF3O3S/c1-31(2)26-12-8-22(9-13-26)6-7-23-14-18-33-20-16-25-11-10-24-15-19-32-17-4-3-5-27(32)29(24)30(25)28(33)21-23;2*2-1(3,4)8(5,6)7/h3-14,17-18,21H,15-16,19-20H2,1-2H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | AEYYTFVYLNYRGK-UHFFFAOYSA-L |
| XLogP | 5.05 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|