C21H18F3NO3S — CID 50992466
11-(4-methylphenyl)-6,7-dihydrobenzo[a]quinolizin-5-ium;trifluoromethanesulfonate (PubChem CID 50992466) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is 11-(4-methylphenyl)-6,7-dihydrobenzo[a]quinolizin-5-ium;trifluoromethanesulfonate.
| Compound Name | 11-(4-methylphenyl)-6,7-dihydrobenzo[a]quinolizin-5-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 50992466 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 11-(4-methylphenyl)-6,7-dihydrobenzo[a]quinolizin-5-ium;trifluoromethanesulfonate |
| SMILES | Cc1ccc(-c2cccc3c2-c2cccc[n+]2CC3)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H18N.CHF3O3S/c1-15-8-10-16(11-9-15)18-6-4-5-17-12-14-21-13-3-2-7-19(21)20(17)18;2-1(3,4)8(5,6)7/h2-11,13H,12,14H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GCQPTLYKZAZDFE-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|