C16H20N2O4 — CID 11854024
N-[3-(dimethylamino)propyl]-6-methoxy-4-oxochromene-2-carboxamide (PubChem CID 11854024) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-methoxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-methoxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 11854024 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-methoxy-4-oxochromene-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NCCCN(C)C)cc(=O)c2c1 |
| InChI | InChI=1S/C16H20N2O4/c1-18(2)8-4-7-17-16(20)15-10-13(19)12-9-11(21-3)5-6-14(12)22-15/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,20) |
| InChIKey | GDOPWMKSJWWPKB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|