C15H18N2O5 — CID 11854018
N-[3-(dimethylamino)propyl]-5,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 11854018) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 11854018 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(=O)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C15H18N2O5/c1-17(2)5-3-4-16-15(21)13-8-11(20)14-10(19)6-9(18)7-12(14)22-13/h6-8,18-19H,3-5H2,1-2H3,(H,16,21) |
| InChIKey | VKEWMIVDQJUVCC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|