C18H20Cl2N6O4 — CID 118540266
1-[2-chloro-7-[1-(2-methoxyethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-3-(5-chloro-6-methoxy-3-pyridinyl)urea (PubChem CID 118540266) has the molecular formula C18H20Cl2N6O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is 1-[2-chloro-7-[1-(2-methoxyethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-3-(5-chloro-6-methoxy-3-pyridinyl)urea.
| Compound Name | 1-[2-chloro-7-[1-(2-methoxyethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-3-(5-chloro-6-methoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 118540266 |
| Molecular Formula | C18H20Cl2N6O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1-[2-chloro-7-[1-(2-methoxyethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-3-(5-chloro-6-methoxy-3-pyridinyl)urea |
| SMILES | COCCOC(C)c1c(NC(=O)Nc2cnc(OC)c(Cl)c2)cnc2cc(Cl)nn12 |
| InChI | InChI=1S/C18H20Cl2N6O4/c1-10(30-5-4-28-2)16-13(9-21-15-7-14(20)25-26(15)16)24-18(27)23-11-6-12(19)17(29-3)22-8-11/h6-10H,4-5H2,1-3H3,(H2,23,24,27) |
| InChIKey | KVTVMJKXWLQAOO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|