C19H22Cl2N8O4 — CID 172561640
3-chloro-5-[[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]carbamoylamino]-N-[2-(methylamino)ethoxy]pyridine-2-carboxamide (PubChem CID 172561640) has the molecular formula C19H22Cl2N8O4 and a molecular weight of 497.34 g/mol. Its IUPAC name is 3-chloro-5-[[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]carbamoylamino]-N-[2-(methylamino)ethoxy]pyridine-2-carboxamide.
| Compound Name | 3-chloro-5-[[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]carbamoylamino]-N-[2-(methylamino)ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 172561640 |
| Molecular Formula | C19H22Cl2N8O4 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-chloro-5-[[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]carbamoylamino]-N-[2-(methylamino)ethoxy]pyridine-2-carboxamide |
| SMILES | CNCCONC(=O)c1ncc(NC(=O)Nc2cnc3cc(Cl)nn3c2[C@H](C)OC)cc1Cl |
| InChI | InChI=1S/C19H22Cl2N8O4/c1-10(32-3)17-13(9-23-15-7-14(21)27-29(15)17)26-19(31)25-11-6-12(20)16(24-8-11)18(30)28-33-5-4-22-2/h6-10,22H,4-5H2,1-3H3,(H,28,30)(H2,25,26,31)/t10-/m0/s1 |
| InChIKey | LSPOHAMRNGKFJI-JTQLQIEISA-N |
| XLogP | 2.66 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|