C24H33ClN4O2 — CID 118541414
N-[5-chloro-3-[[4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyanobutanamide (PubChem CID 118541414) has the molecular formula C24H33ClN4O2 and a molecular weight of 445.01 g/mol. Its IUPAC name is N-[5-chloro-3-[[4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyanobutanamide.
| Compound Name | N-[5-chloro-3-[[4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyanobutanamide |
|---|---|
| PubChem CID | 118541414 |
| Molecular Formula | C24H33ClN4O2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[5-chloro-3-[[4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyanobutanamide |
| SMILES | Cc1c(CN2CCN(C(=O)C3CCCC3)C(C)C2)cc(Cl)cc1NC(=O)CCCC#N |
| InChI | InChI=1S/C24H33ClN4O2/c1-17-15-28(11-12-29(17)24(31)19-7-3-4-8-19)16-20-13-21(25)14-22(18(20)2)27-23(30)9-5-6-10-26/h13-14,17,19H,3-9,11-12,15-16H2,1-2H3,(H,27,30) |
| InChIKey | NGKHAJANRHPUJR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|