C25H41ClN4O2 — CID 144965722
[(2S)-4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone;4-(methylamino)butanal (PubChem CID 144965722) has the molecular formula C25H41ClN4O2 and a molecular weight of 465.08 g/mol. Its IUPAC name is [(2S)-4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone;4-(methylamino)butanal.
| Compound Name | [(2S)-4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone;4-(methylamino)butanal |
|---|---|
| PubChem CID | 144965722 |
| Molecular Formula | C25H41ClN4O2 |
| Molecular Weight | 465.08 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [(2S)-4-[[5-chloro-2-methyl-3-(methylamino)phenyl]methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone;4-(methylamino)butanal |
| SMILES | CNCCCC=O.CNc1cc(Cl)cc(CN2CCN(C(=O)C3CCCC3)[C@@H](C)C2)c1C |
| InChI | InChI=1S/C20H30ClN3O.C5H11NO/c1-14-12-23(8-9-24(14)20(25)16-6-4-5-7-16)13-17-10-18(21)11-19(22-3)15(17)2;1-6-4-2-3-5-7/h10-11,14,16,22H,4-9,12-13H2,1-3H3;5-6H,2-4H2,1H3/t14-;/m0./s1 |
| InChIKey | NKWSKIRRYTURFJ-UQKRIMTDSA-N |
| XLogP | 4.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.08 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|