C19H28ClN3O — CID 90204308
[(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone (PubChem CID 90204308) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is [(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 90204308 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone |
| SMILES | Cc1c(N)cc(Cl)cc1CN1CCN(C(=O)C2CCCC2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H28ClN3O/c1-13-11-22(12-16-9-17(20)10-18(21)14(16)2)7-8-23(13)19(24)15-5-3-4-6-15/h9-10,13,15H,3-8,11-12,21H2,1-2H3/t13-/m0/s1 |
| InChIKey | SOOHVEZAXYVGEZ-ZDUSSCGKSA-N |
| XLogP | 3.45 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|