C28H21ClF2N2O3 — CID 118542469
4-[[2-[5-(3-chloro-2,6-difluorophenyl)-6-methyl-2-pyridinyl]-3-phenylpropanoyl]amino]benzoic acid (PubChem CID 118542469) has the molecular formula C28H21ClF2N2O3 and a molecular weight of 506.94 g/mol. Its IUPAC name is 4-[[2-[5-(3-chloro-2,6-difluorophenyl)-6-methyl-2-pyridinyl]-3-phenylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-(3-chloro-2,6-difluorophenyl)-6-methyl-2-pyridinyl]-3-phenylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 118542469 |
| Molecular Formula | C28H21ClF2N2O3 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[[2-[5-(3-chloro-2,6-difluorophenyl)-6-methyl-2-pyridinyl]-3-phenylpropanoyl]amino]benzoic acid |
| SMILES | Cc1nc(C(Cc2ccccc2)C(=O)Nc2ccc(C(=O)O)cc2)ccc1-c1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C28H21ClF2N2O3/c1-16-20(25-23(30)13-12-22(29)26(25)31)11-14-24(32-16)21(15-17-5-3-2-4-6-17)27(34)33-19-9-7-18(8-10-19)28(35)36/h2-14,21H,15H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | GGNGHVJPSWFIMQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|