C27H26ClFN3O4+ — CID 144970083
4-[[2-[5-(3-chloro-6-cyano-2-fluorophenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid;ethane (PubChem CID 144970083) has the molecular formula C27H26ClFN3O4+ and a molecular weight of 510.97 g/mol. Its IUPAC name is 4-[[2-[5-(3-chloro-6-cyano-2-fluorophenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid;ethane.
| Compound Name | 4-[[2-[5-(3-chloro-6-cyano-2-fluorophenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid;ethane |
|---|---|
| PubChem CID | 144970083 |
| Molecular Formula | C27H26ClFN3O4+ |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 4-[[2-[5-(3-chloro-6-cyano-2-fluorophenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid;ethane |
| SMILES | CC.N#Cc1ccc(Cl)c(F)c1-c1ccc(C(CC2CC2)C(=O)Nc2ccc(C(=O)O)cc2)[n+](O)c1 |
| InChI | InChI=1S/C25H19ClFN3O4.C2H6/c26-20-9-5-16(12-28)22(23(20)27)17-6-10-21(30(34)13-17)19(11-14-1-2-14)24(31)29-18-7-3-15(4-8-18)25(32)33;1-2/h3-10,13-14,19H,1-2,11H2,(H2-,29,31,32,33,34);1-2H3/p+1 |
| InChIKey | FNVWVUCLDJKHHJ-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|