C27H24ClN4O4+ — CID 144970071
4-[[2-[5-(5-chloro-2-pyrazol-1-ylphenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid (PubChem CID 144970071) has the molecular formula C27H24ClN4O4+ and a molecular weight of 503.97 g/mol. Its IUPAC name is 4-[[2-[5-(5-chloro-2-pyrazol-1-ylphenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[5-(5-chloro-2-pyrazol-1-ylphenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 144970071 |
| Molecular Formula | C27H24ClN4O4+ |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-[[2-[5-(5-chloro-2-pyrazol-1-ylphenyl)-1-hydroxypyridin-1-ium-2-yl]-3-cyclopropylpropanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C(CC2CC2)c2ccc(-c3cc(Cl)ccc3-n3cccn3)c[n+]2O)cc1 |
| InChI | InChI=1S/C27H23ClN4O4/c28-20-7-11-24(31-13-1-12-29-31)22(15-20)19-6-10-25(32(36)16-19)23(14-17-2-3-17)26(33)30-21-8-4-18(5-9-21)27(34)35/h1,4-13,15-17,23H,2-3,14H2,(H2-,30,33,34,35,36)/p+1 |
| InChIKey | BJVJEIKSCLQVAY-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|